C18H21N3O3S — CID 47091651
N-[4-[[2-(3-hydroxypiperidin-1-yl)acetyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 47091651) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[4-[[2-(3-hydroxypiperidin-1-yl)acetyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[2-(3-hydroxypiperidin-1-yl)acetyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47091651 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[4-[[2-(3-hydroxypiperidin-1-yl)acetyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(CN1CCCC(O)C1)Nc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H21N3O3S/c22-15-3-1-9-21(11-15)12-17(23)19-13-5-7-14(8-6-13)20-18(24)16-4-2-10-25-16/h2,4-8,10,15,22H,1,3,9,11-12H2,(H,19,23)(H,20,24) |
| InChIKey | CTAGFCMANCMKJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |