C13H19N3O4S — CID 81209025
N'-[2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]acetyl]thiophene-2-carbohydrazide (PubChem CID 81209025) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is N'-[2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 81209025 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N'-[2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]acetyl]thiophene-2-carbohydrazide |
| SMILES | CC1COC(CO)CN1CC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H19N3O4S/c1-9-8-20-10(7-17)5-16(9)6-12(18)14-15-13(19)11-3-2-4-21-11/h2-4,9-10,17H,5-8H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | YPQPKVMEFGVMEQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|