C12H18N4O2S — CID 82756313
N'-[2-[(2S)-2-methylpiperazin-1-yl]acetyl]thiophene-2-carbohydrazide (PubChem CID 82756313) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N'-[2-[(2S)-2-methylpiperazin-1-yl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(2S)-2-methylpiperazin-1-yl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 82756313 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N'-[2-[(2S)-2-methylpiperazin-1-yl]acetyl]thiophene-2-carbohydrazide |
| SMILES | C[C@H]1CNCCN1CC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C12H18N4O2S/c1-9-7-13-4-5-16(9)8-11(17)14-15-12(18)10-3-2-6-19-10/h2-3,6,9,13H,4-5,7-8H2,1H3,(H,14,17)(H,15,18)/t9-/m0/s1 |
| InChIKey | QHOSMEPPSXRFNB-VIFPVBQESA-N |
| XLogP | -0.20 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|