C12H18N4O2S — CID 103577312
N'-[2-(3-amino-4-methylpyrrolidin-1-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 103577312) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N'-[2-(3-amino-4-methylpyrrolidin-1-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(3-amino-4-methylpyrrolidin-1-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 103577312 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N'-[2-(3-amino-4-methylpyrrolidin-1-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | CC1CN(CC(=O)NNC(=O)c2cccs2)CC1N |
| InChI | InChI=1S/C12H18N4O2S/c1-8-5-16(6-9(8)13)7-11(17)14-15-12(18)10-3-2-4-19-10/h2-4,8-9H,5-7,13H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | UXWTYGMLXNOPOA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|