C13H17N3O2S2 — CID 54786564
2-cyclopentyl-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide (PubChem CID 54786564) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54786564 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-cyclopentyl-N-[(thiophene-2-carbonylamino)carbamothioyl]acetamide |
| SMILES | O=C(CC1CCCC1)NC(=S)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H17N3O2S2/c17-11(8-9-4-1-2-5-9)14-13(19)16-15-12(18)10-6-3-7-20-10/h3,6-7,9H,1-2,4-5,8H2,(H,15,18)(H2,14,16,17,19) |
| InChIKey | BAQLHNBWHFPTQF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|