C20H17F3N2O3 — CID 2035295
5-methoxy-2-[5-(4-methoxyphenyl)-2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol (PubChem CID 2035295) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 5-methoxy-2-[5-(4-methoxyphenyl)-2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol.
| Compound Name | 5-methoxy-2-[5-(4-methoxyphenyl)-2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 2035295 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-methoxy-2-[5-(4-methoxyphenyl)-2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3O)nc(C)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O3/c1-11-24-18(15-9-8-14(28-3)10-16(15)26)17(19(25-11)20(21,22)23)12-4-6-13(27-2)7-5-12/h4-10,26H,1-3H3 |
| InChIKey | VFEHLPJMPAIDSP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |