C17H23N7O2 — CID 20383
ethyl 4-[[2,4-diamino-6-(diethylamino)pyrimidin-5-yl]diazenyl]benzoate (PubChem CID 20383) has the molecular formula C17H23N7O2 and a molecular weight of 357.42 g/mol. Its IUPAC name is ethyl 4-[[2,4-diamino-6-(diethylamino)pyrimidin-5-yl]diazenyl]benzoate.
| Compound Name | ethyl 4-[[2,4-diamino-6-(diethylamino)pyrimidin-5-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 20383 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | ethyl 4-[[2,4-diamino-6-(diethylamino)pyrimidin-5-yl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/c2c(N)nc(N)nc2N(CC)CC)cc1 |
| InChI | InChI=1S/C17H23N7O2/c1-4-24(5-2)15-13(14(18)20-17(19)21-15)23-22-12-9-7-11(8-10-12)16(25)26-6-3/h7-10H,4-6H2,1-3H3,(H4,18,19,20,21)/b23-22+ |
| InChIKey | TYKDUZBCZNUTDM-GHVJWSGMSA-N |
| XLogP | 3.08 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|