C18H14N3O5- — CID 2040602
(E)-4-[[(2R)-2-(4-hydroxyphenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]amino]-4-oxobut-2-enoate (PubChem CID 2040602) has the molecular formula C18H14N3O5- and a molecular weight of 352.33 g/mol. Its IUPAC name is (E)-4-[[(2R)-2-(4-hydroxyphenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]amino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[[(2R)-2-(4-hydroxyphenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2040602 |
| Molecular Formula | C18H14N3O5- |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (E)-4-[[(2R)-2-(4-hydroxyphenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]amino]-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)NN1C(=O)c2ccccc2N[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H15N3O5/c22-12-7-5-11(6-8-12)17-19-14-4-2-1-3-13(14)18(26)21(17)20-15(23)9-10-16(24)25/h1-10,17,19,22H,(H,20,23)(H,24,25)/p-1/b10-9+/t17-/m1/s1 |
| InChIKey | RVVSNJGDKLICKB-OAGJVSPASA-M |
| XLogP | 0.30 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|