C22H17N2O3- — CID 9006782
4-[(2R)-3-benzyl-4-oxo-1,2-dihydroquinazolin-2-yl]benzoate (PubChem CID 9006782) has the molecular formula C22H17N2O3- and a molecular weight of 357.39 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,2-dihydroquinazolin-2-yl]benzoate.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,2-dihydroquinazolin-2-yl]benzoate |
|---|---|
| PubChem CID | 9006782 |
| Molecular Formula | C22H17N2O3- |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,2-dihydroquinazolin-2-yl]benzoate |
| SMILES | O=C([O-])c1ccc([C@@H]2Nc3ccccc3C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O3/c25-21-18-8-4-5-9-19(18)23-20(16-10-12-17(13-11-16)22(26)27)24(21)14-15-6-2-1-3-7-15/h1-13,20,23H,14H2,(H,26,27)/p-1/t20-/m1/s1 |
| InChIKey | SOFNDAODLAEYBG-HXUWFJFHSA-M |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |