C19H16N2OS — CID 9006718
(2S)-3-benzyl-2-thiophen-3-yl-1,2-dihydroquinazolin-4-one (PubChem CID 9006718) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is (2S)-3-benzyl-2-thiophen-3-yl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-benzyl-2-thiophen-3-yl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9006718 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2S)-3-benzyl-2-thiophen-3-yl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@H](c2ccsc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H16N2OS/c22-19-16-8-4-5-9-17(16)20-18(15-10-11-23-13-15)21(19)12-14-6-2-1-3-7-14/h1-11,13,18,20H,12H2/t18-/m0/s1 |
| InChIKey | UECCYZKSNPHXBB-SFHVURJKSA-N |
| XLogP | 4.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |