C26H25N3O5S — CID 2042017
(2E)-2-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 2042017) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is (2E)-2-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | (2E)-2-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 2042017 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (2E)-2-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | C=CCOc1ccc(/C=c2/sc3nc(=O)c(Cc4ccc(OCCC)cc4)nn3c2=O)cc1OC |
| InChI | InChI=1S/C26H25N3O5S/c1-4-12-33-19-9-6-17(7-10-19)14-20-24(30)27-26-29(28-20)25(31)23(35-26)16-18-8-11-21(34-13-5-2)22(15-18)32-3/h5-11,15-16H,2,4,12-14H2,1,3H3/b23-16+ |
| InChIKey | WHAWTAORGSNZJF-XQNSMLJCSA-N |
| XLogP | 3.01 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|