C22H17Cl2N3O3S — CID 4983811
2-[(3,4-dichlorophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 4983811) has the molecular formula C22H17Cl2N3O3S and a molecular weight of 474.37 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | 2-[(3,4-dichlorophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 4983811 |
| Molecular Formula | C22H17Cl2N3O3S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | CCCOc1ccc(Cc2nn3c(=O)c(=Cc4ccc(Cl)c(Cl)c4)sc3nc2=O)cc1 |
| InChI | InChI=1S/C22H17Cl2N3O3S/c1-2-9-30-15-6-3-13(4-7-15)11-18-20(28)25-22-27(26-18)21(29)19(31-22)12-14-5-8-16(23)17(24)10-14/h3-8,10,12H,2,9,11H2,1H3 |
| InChIKey | AOZMRLWZNFQXRF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'} |
|---|