C21H17Cl2N3O2S — CID 2912685
2-(4-butoxyphenyl)-5-[(3,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 2912685) has the molecular formula C21H17Cl2N3O2S and a molecular weight of 446.36 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-[(3,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 2-(4-butoxyphenyl)-5-[(3,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 2912685 |
| Molecular Formula | C21H17Cl2N3O2S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-[(3,4-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCCOc1ccc(-c2nc3sc(=Cc4ccc(Cl)c(Cl)c4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O2S/c1-2-3-10-28-15-7-5-14(6-8-15)19-24-21-26(25-19)20(27)18(29-21)12-13-4-9-16(22)17(23)11-13/h4-9,11-12H,2-3,10H2,1H3 |
| InChIKey | KTTFMZVIIRHKMK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|