C22H18N4O5S — CID 3490497
2-[(2-nitrophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 3490497) has the molecular formula C22H18N4O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | 2-[(2-nitrophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 3490497 |
| Molecular Formula | C22H18N4O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[(2-nitrophenyl)methylidene]-6-[(4-propoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | CCCOc1ccc(Cc2nn3c(=O)c(=Cc4ccccc4[N+](=O)[O-])sc3nc2=O)cc1 |
| InChI | InChI=1S/C22H18N4O5S/c1-2-11-31-16-9-7-14(8-10-16)12-17-20(27)23-22-25(24-17)21(28)19(32-22)13-15-5-3-4-6-18(15)26(29)30/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | FJCIEERQTISZHI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|