C31H24N6O5S — CID 6531295
(2Z)-2-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-[(4-methylphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 6531295) has the molecular formula C31H24N6O5S and a molecular weight of 592.64 g/mol. Its IUPAC name is (2Z)-2-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-[(4-methylphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | (2Z)-2-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-[(4-methylphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 6531295 |
| Molecular Formula | C31H24N6O5S |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | (2Z)-2-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-6-[(4-methylphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=c2\sc3nc(=O)c(Cc4ccc(C)cc4)nn3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H24N6O5S/c1-3-42-26-14-13-21(16-25(26)37(40)41)28-22(18-35(34-28)23-7-5-4-6-8-23)17-27-30(39)36-31(43-27)32-29(38)24(33-36)15-20-11-9-19(2)10-12-20/h4-14,16-18H,3,15H2,1-2H3/b27-17- |
| InChIKey | XFNCEIGGUNJYAG-PKAZHMFMSA-N |
| XLogP | 4.12 |
| TPSA | 134.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|