C28H20N6O5S — CID 4503255
5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 4503255) has the molecular formula C28H20N6O5S and a molecular weight of 552.57 g/mol. Its IUPAC name is 5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 4503255 |
| Molecular Formula | C28H20N6O5S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | COc1ccc(-c2nc3sc(=Cc4cn(-c5ccccc5)nc4-c4ccc(OC)c([N+](=O)[O-])c4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C28H20N6O5S/c1-38-21-11-8-17(9-12-21)26-29-28-33(31-26)27(35)24(40-28)15-19-16-32(20-6-4-3-5-7-20)30-25(19)18-10-13-23(39-2)22(14-18)34(36)37/h3-16H,1-2H3 |
| InChIKey | HDRVLVFRLBVRNG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 126.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|