C27H16Cl2N6O4S — CID 4503263
2-(2,4-dichlorophenyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 4503263) has the molecular formula C27H16Cl2N6O4S and a molecular weight of 591.44 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 2-(2,4-dichlorophenyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 4503263 |
| Molecular Formula | C27H16Cl2N6O4S |
| Molecular Weight | 591.44 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(-c4ccc(Cl)cc4Cl)nn3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H16Cl2N6O4S/c1-39-22-10-7-15(11-21(22)35(37)38)24-16(14-33(31-24)18-5-3-2-4-6-18)12-23-26(36)34-27(40-23)30-25(32-34)19-9-8-17(28)13-20(19)29/h2-14H,1H3 |
| InChIKey | FTFRTCJHASZIRX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 117.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|