About 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one
2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one (PubChem CID 20443040) has the molecular formula C27H28F2N2O2
and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one |
| PubChem CID | 20443040 |
| Molecular Formula | C27H28F2N2O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-1-phenylethanone |
| SMILES | C1CN(CCN1CCOC(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)CC(=O)C4=CC=CC=C4 |
| InChI | InChI=1S/C27H28F2N2O2/c28-24-10-6-22(7-11-24)27(23-8-12-25(29)13-9-23)33-19-18-30-14-16-31(17-15-30)20-26(32)21-4-2-1-3-5-21/h1-13,27H,14-20H2 |
| InChIKey | PLTVEFQGFXRXRM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | 555 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one?
The IUPAC name of 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one (CID 20443040) is 2-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-1-phenylethanone.
What is the SMILES notation for 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one?
The canonical SMILES for 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one is C1CN(CCN1CCOC(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)CC(=O)C4=CC=CC=C4.
What is the InChIKey of 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one?
The InChIKey is PLTVEFQGFXRXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28F2N2O2/c28-24-10-6-22(7-11-24)27(23-8-12-25(29)13-9-23)33-19-18-30-14-16-31(17-15-30)20-26(32)21-4-2-1-3-5-21/h1-13,27H,14-20H2.
What are the key properties of 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one?
2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one has a molecular weight of 450.50 g/mol, XLogP of 4.70, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-{2-[Bis(4-fluorophenyl)methoxy]ethyl}piperazin-1-yl)-1-phenylethan-1-one is sourced from PubChem (CID 20443040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).