About 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one
3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one (PubChem CID 10693838) has the molecular formula C28H32N2O2
and a molecular weight of 428.60 g/mol. Its IUPAC name is 3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one |
| PubChem CID | 10693838 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]-1-phenylpropan-1-one |
| SMILES | C1CN(CCN1CCC(=O)C2=CC=CC=C2)CCOC(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C28H32N2O2/c31-27(24-10-4-1-5-11-24)16-17-29-18-20-30(21-19-29)22-23-32-28(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,28H,16-23H2 |
| InChIKey | RBFITAWVAXQBNB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | 510 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one?
The IUPAC name of 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one (CID 10693838) is 3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]-1-phenylpropan-1-one.
What is the SMILES notation for 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one?
The canonical SMILES for 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one is C1CN(CCN1CCC(=O)C2=CC=CC=C2)CCOC(C3=CC=CC=C3)C4=CC=CC=C4.
What is the InChIKey of 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one?
The InChIKey is RBFITAWVAXQBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32N2O2/c31-27(24-10-4-1-5-11-24)16-17-29-18-20-30(21-19-29)22-23-32-28(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,28H,16-23H2.
What are the key properties of 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one?
3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one has a molecular weight of 428.60 g/mol, XLogP of 4.40, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylpropan-1-one is sourced from PubChem (CID 10693838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).