About 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one
2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one (PubChem CID 24825334) has the molecular formula C27H30N2O2
and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]-1-phenylethanone.
Molecular Properties
| Compound Name | 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one |
| PubChem CID | 24825334 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]-1-phenylethanone |
| SMILES | C1CN(CCN1CCOC(C2=CC=CC=C2)C3=CC=CC=C3)CC(=O)C4=CC=CC=C4 |
| InChI | InChI=1S/C27H30N2O2/c30-26(23-10-4-1-5-11-23)22-29-18-16-28(17-19-29)20-21-31-27(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,27H,16-22H2 |
| InChIKey | KHBBVPNKEBAUQS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | 495 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one?
The IUPAC name of 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one (CID 24825334) is 2-[4-(2-benzhydryloxyethyl)piperazin-1-yl]-1-phenylethanone.
What is the SMILES notation for 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one?
The canonical SMILES for 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one is C1CN(CCN1CCOC(C2=CC=CC=C2)C3=CC=CC=C3)CC(=O)C4=CC=CC=C4.
What is the InChIKey of 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one?
The InChIKey is KHBBVPNKEBAUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N2O2/c30-26(23-10-4-1-5-11-23)22-29-18-16-28(17-19-29)20-21-31-27(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,27H,16-22H2.
What are the key properties of 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one?
2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one has a molecular weight of 414.50 g/mol, XLogP of 4.50, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-{4-[2-(Diphenylmethoxy)ethyl]piperazin-1-yl}-1-phenylethan-1-one is sourced from PubChem (CID 24825334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).