C23H32N4O3 — CID 2045371
9,10-dimethoxy-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 2045371) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 9,10-dimethoxy-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 9,10-dimethoxy-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 2045371 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 9,10-dimethoxy-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | COc1cc2c(cc1OC)-c1cc(NC3CC(C)(C)NC(C)(C)C3)nc(=O)n1CC2 |
| InChI | InChI=1S/C23H32N4O3/c1-22(2)12-15(13-23(3,4)26-22)24-20-11-17-16-10-19(30-6)18(29-5)9-14(16)7-8-27(17)21(28)25-20/h9-11,15,26H,7-8,12-13H2,1-6H3,(H,24,25,28) |
| InChIKey | MTUURDUNQJTNNA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |