C22H27N3O3 — CID 3964814
2-[2-(cyclohexen-1-yl)ethylamino]-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 3964814) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 3964814 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | COc1cc2c(cc1OC)-c1cc(NCCC3=CCCCC3)nc(=O)n1CC2 |
| InChI | InChI=1S/C22H27N3O3/c1-27-19-12-16-9-11-25-18(17(16)13-20(19)28-2)14-21(24-22(25)26)23-10-8-15-6-4-3-5-7-15/h6,12-14H,3-5,7-11H2,1-2H3,(H,23,24,26) |
| InChIKey | QDHVLJHPCHBZFB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|