C27H19ClN2O3 — CID 2046542
(1S,2S,3aR)-1-acetyl-7-chloro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 2046542) has the molecular formula C27H19ClN2O3 and a molecular weight of 454.91 g/mol. Its IUPAC name is (1S,2S,3aR)-1-acetyl-7-chloro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2S,3aR)-1-acetyl-7-chloro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 2046542 |
| Molecular Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (1S,2S,3aR)-1-acetyl-7-chloro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | CC(=O)[C@@H]1[C@@H](c2cccnc2)C2(C(=O)c3ccccc3C2=O)[C@H]2C=Cc3cc(Cl)ccc3N12 |
| InChI | InChI=1S/C27H19ClN2O3/c1-15(31)24-23(17-5-4-12-29-14-17)27(25(32)19-6-2-3-7-20(19)26(27)33)22-11-8-16-13-18(28)9-10-21(16)30(22)24/h2-14,22-24H,1H3/t22-,23-,24-/m1/s1 |
| InChIKey | QCVXZSKFQOKCRS-WXFUMESZSA-N |
| XLogP | 4.76 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|