C18H16N2O4S — CID 2049348
1-(2-methoxyphenyl)-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 2049348) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(2-methoxyphenyl)-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 2049348 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(3-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cccc(N2C(=O)CC(=O)N(c3ccccc3OC)C2=S)c1 |
| InChI | InChI=1S/C18H16N2O4S/c1-23-13-7-5-6-12(10-13)19-16(21)11-17(22)20(18(19)25)14-8-3-4-9-15(14)24-2/h3-10H,11H2,1-2H3 |
| InChIKey | ZIALWGCOGZPNQK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|