C7H5Cl2N3S — CID 2049848
(4,7-dichloro-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 2049848) has the molecular formula C7H5Cl2N3S and a molecular weight of 234.11 g/mol. Its IUPAC name is (4,7-dichloro-1,3-benzothiazol-2-yl)hydrazine.
| Compound Name | (4,7-dichloro-1,3-benzothiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 2049848 |
| Molecular Formula | C7H5Cl2N3S |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | (4,7-dichloro-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | NNc1nc2c(Cl)ccc(Cl)c2s1 |
| InChI | InChI=1S/C7H5Cl2N3S/c8-3-1-2-4(9)6-5(3)11-7(12-10)13-6/h1-2H,10H2,(H,11,12) |
| InChIKey | RRAGSBRZTNXWEH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|