About 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid
5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid (PubChem CID 20501) has the molecular formula C8H6O5
and a molecular weight of 182.13 g/mol. Its IUPAC name is 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid.
Analyze 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid?
The IUPAC name of 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid (CID 20501) is 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid.
What is the SMILES notation for 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid?
The canonical SMILES for 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid is O=C(O)c1cc(O)c(O)cc(=O)c1.
What is the InChIKey of 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid?
The InChIKey is ZGKNMKBZOSTFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,10-11H,(H,12,13).
What are the key properties of 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid?
5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid has a molecular weight of 182.13 g/mol, XLogP of 0.16, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid is sourced from PubChem (CID 20501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).