C16H22BrNO4S — CID 20505851
2-bromo-5-(3,5-diethylpiperidin-1-yl)sulfonylbenzoic acid (PubChem CID 20505851) has the molecular formula C16H22BrNO4S and a molecular weight of 404.33 g/mol. Its IUPAC name is 2-bromo-5-(3,5-diethylpiperidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 2-bromo-5-(3,5-diethylpiperidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 20505851 |
| Molecular Formula | C16H22BrNO4S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2-bromo-5-(3,5-diethylpiperidin-1-yl)sulfonylbenzoic acid |
| SMILES | CCC1CC(CC)CN(S(=O)(=O)c2ccc(Br)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C16H22BrNO4S/c1-3-11-7-12(4-2)10-18(9-11)23(21,22)13-5-6-15(17)14(8-13)16(19)20/h5-6,8,11-12H,3-4,7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | RAAGSFUIVSLKCO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |