C23H36N2O4S — CID 20505934
5-(3,5-dipropylpiperidin-1-yl)sulfonyl-2-piperidin-1-ylbenzoic acid (PubChem CID 20505934) has the molecular formula C23H36N2O4S and a molecular weight of 436.62 g/mol. Its IUPAC name is 5-(3,5-dipropylpiperidin-1-yl)sulfonyl-2-piperidin-1-ylbenzoic acid.
| Compound Name | 5-(3,5-dipropylpiperidin-1-yl)sulfonyl-2-piperidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 20505934 |
| Molecular Formula | C23H36N2O4S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 5-(3,5-dipropylpiperidin-1-yl)sulfonyl-2-piperidin-1-ylbenzoic acid |
| SMILES | CCCC1CC(CCC)CN(S(=O)(=O)c2ccc(N3CCCCC3)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C23H36N2O4S/c1-3-8-18-14-19(9-4-2)17-25(16-18)30(28,29)20-10-11-22(21(15-20)23(26)27)24-12-6-5-7-13-24/h10-11,15,18-19H,3-9,12-14,16-17H2,1-2H3,(H,26,27) |
| InChIKey | UAVAICBPTAKDHC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |