2,2-dichlorohexanoyl chloride

C6H9Cl3O — CID 20509297

IUPAC2,2-dichlorohexanoyl chloride
SMILESCCCCC(Cl)(Cl)C(=O)Cl
InChIInChI=1S/C6H9Cl3O/c1-2-3-4-6(8,9)5(7)10/h2-4H2,1H3
InChIKeyUAEHKZLHKOEFFM-UHFFFAOYSA-N
MW203.50 g/mol
LogP3.12
Rot. Bonds4

About 2,2-dichlorohexanoyl chloride

2,2-dichlorohexanoyl chloride (PubChem CID 20509297) has the molecular formula C6H9Cl3O and a molecular weight of 203.50 g/mol. Its IUPAC name is 2,2-dichlorohexanoyl chloride.

Molecular Properties

Compound Name2,2-dichlorohexanoyl chloride
PubChem CID20509297
Molecular FormulaC6H9Cl3O
Molecular Weight203.50 g/mol
Exact Mass201.97
IUPAC Name2,2-dichlorohexanoyl chloride
SMILESCCCCC(Cl)(Cl)C(=O)Cl
InChIInChI=1S/C6H9Cl3O/c1-2-3-4-6(8,9)5(7)10/h2-4H2,1H3
InChIKeyUAEHKZLHKOEFFM-UHFFFAOYSA-N
XLogP3.12
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.50
LogP ≤ 53.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,2-dichlorohexanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dichlorohexanoyl chloride?
The IUPAC name of 2,2-dichlorohexanoyl chloride (CID 20509297) is 2,2-dichlorohexanoyl chloride.
What is the SMILES notation for 2,2-dichlorohexanoyl chloride?
The canonical SMILES for 2,2-dichlorohexanoyl chloride is CCCCC(Cl)(Cl)C(=O)Cl.
What is the InChIKey of 2,2-dichlorohexanoyl chloride?
The InChIKey is UAEHKZLHKOEFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl3O/c1-2-3-4-6(8,9)5(7)10/h2-4H2,1H3.
What are the key properties of 2,2-dichlorohexanoyl chloride?
2,2-dichlorohexanoyl chloride has a molecular weight of 203.50 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichlorohexanoyl chloride is sourced from PubChem (CID 20509297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).