2,2,5,5,5-pentachloropentanoyl chloride

C5H4Cl6O — CID 171063217

IUPAC2,2,5,5,5-pentachloropentanoyl chloride
SMILESO=C(Cl)C(Cl)(Cl)CCC(Cl)(Cl)Cl
InChIInChI=1S/C5H4Cl6O/c6-3(12)4(7,8)1-2-5(9,10)11/h1-2H2
InChIKeyFDJPZBBVZZOGFU-UHFFFAOYSA-N
MW292.80 g/mol
LogP4.08
Rot. Bonds3

About 2,2,5,5,5-pentachloropentanoyl chloride

2,2,5,5,5-pentachloropentanoyl chloride (PubChem CID 171063217) has the molecular formula C5H4Cl6O and a molecular weight of 292.80 g/mol. Its IUPAC name is 2,2,5,5,5-pentachloropentanoyl chloride.

Molecular Properties

Compound Name2,2,5,5,5-pentachloropentanoyl chloride
PubChem CID171063217
Molecular FormulaC5H4Cl6O
Molecular Weight292.80 g/mol
Exact Mass289.84
IUPAC Name2,2,5,5,5-pentachloropentanoyl chloride
SMILESO=C(Cl)C(Cl)(Cl)CCC(Cl)(Cl)Cl
InChIInChI=1S/C5H4Cl6O/c6-3(12)4(7,8)1-2-5(9,10)11/h1-2H2
InChIKeyFDJPZBBVZZOGFU-UHFFFAOYSA-N
XLogP4.08
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.80
LogP ≤ 54.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,2,5,5,5-pentachloropentanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,5,5,5-pentachloropentanoyl chloride?
The IUPAC name of 2,2,5,5,5-pentachloropentanoyl chloride (CID 171063217) is 2,2,5,5,5-pentachloropentanoyl chloride.
What is the SMILES notation for 2,2,5,5,5-pentachloropentanoyl chloride?
The canonical SMILES for 2,2,5,5,5-pentachloropentanoyl chloride is O=C(Cl)C(Cl)(Cl)CCC(Cl)(Cl)Cl.
What is the InChIKey of 2,2,5,5,5-pentachloropentanoyl chloride?
The InChIKey is FDJPZBBVZZOGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl6O/c6-3(12)4(7,8)1-2-5(9,10)11/h1-2H2.
What are the key properties of 2,2,5,5,5-pentachloropentanoyl chloride?
2,2,5,5,5-pentachloropentanoyl chloride has a molecular weight of 292.80 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,5,5,5-pentachloropentanoyl chloride is sourced from PubChem (CID 171063217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).