C5H4Cl6O — CID 171063217
2,2,5,5,5-pentachloropentanoyl chloride (PubChem CID 171063217) has the molecular formula C5H4Cl6O and a molecular weight of 292.80 g/mol. Its IUPAC name is 2,2,5,5,5-pentachloropentanoyl chloride.
| Compound Name | 2,2,5,5,5-pentachloropentanoyl chloride |
|---|---|
| PubChem CID | 171063217 |
| Molecular Formula | C5H4Cl6O |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 289.84 |
| IUPAC Name | 2,2,5,5,5-pentachloropentanoyl chloride |
| SMILES | O=C(Cl)C(Cl)(Cl)CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl6O/c6-3(12)4(7,8)1-2-5(9,10)11/h1-2H2 |
| InChIKey | FDJPZBBVZZOGFU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|