2-methyl-2-trichlorogermylpropanoyl chloride

C4H6Cl4GeO — CID 87735387

IUPAC2-methyl-2-trichlorogermylpropanoyl chloride
SMILESCC(C)(C(=O)Cl)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C4H6Cl4GeO/c1-4(2,3(5)10)9(6,7)8/h1-2H3
InChIKeyFWFYBCZIVGWQHN-UHFFFAOYSA-N
MW284.51 g/mol
LogP3.19
Rot. Bonds2

About 2-methyl-2-trichlorogermylpropanoyl chloride

2-methyl-2-trichlorogermylpropanoyl chloride (PubChem CID 87735387) has the molecular formula C4H6Cl4GeO and a molecular weight of 284.51 g/mol. Its IUPAC name is 2-methyl-2-trichlorogermylpropanoyl chloride.

Molecular Properties

Compound Name2-methyl-2-trichlorogermylpropanoyl chloride
PubChem CID87735387
Molecular FormulaC4H6Cl4GeO
Molecular Weight284.51 g/mol
Exact Mass283.84
IUPAC Name2-methyl-2-trichlorogermylpropanoyl chloride
SMILESCC(C)(C(=O)Cl)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C4H6Cl4GeO/c1-4(2,3(5)10)9(6,7)8/h1-2H3
InChIKeyFWFYBCZIVGWQHN-UHFFFAOYSA-N
XLogP3.19
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.51
LogP ≤ 53.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-methyl-2-trichlorogermylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Propanoyl chloride, 3-(trichlorogermyl)-
CID 85211
3-Trichlorogermylbutanoyl chloride
CID 13249036
2-Methyl-3-trichlorogermylpropanoyl chloride
CID 13393242
3-Methyl-3-trichlorogermylbutanoyl chloride
CID 13249037
3,3,3-Trichloro-2,2-dimethylpropanoyl chloride
CID 20236477
2-Trichlorogermylpropanoyl chloride
CID 87735041
2-Trichlorogermylbutanoyl chloride
CID 87735949
CID 88780680
CID 88780680
3-[Chloro(dimethyl)germyl]propanoyl chloride
CID 139726281
Propanoyl chloride;trichlorogermane
CID 173442420
2-Methylpropanedioyl dichloride;dihydrochloride
CID 174742861
2,2-Dimethylpropanoyl chloride;tetrachloromethane
CID 174900107

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-trichlorogermylpropanoyl chloride?
The IUPAC name of 2-methyl-2-trichlorogermylpropanoyl chloride (CID 87735387) is 2-methyl-2-trichlorogermylpropanoyl chloride.
What is the SMILES notation for 2-methyl-2-trichlorogermylpropanoyl chloride?
The canonical SMILES for 2-methyl-2-trichlorogermylpropanoyl chloride is CC(C)(C(=O)Cl)[Ge](Cl)(Cl)Cl.
What is the InChIKey of 2-methyl-2-trichlorogermylpropanoyl chloride?
The InChIKey is FWFYBCZIVGWQHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl4GeO/c1-4(2,3(5)10)9(6,7)8/h1-2H3.
What are the key properties of 2-methyl-2-trichlorogermylpropanoyl chloride?
2-methyl-2-trichlorogermylpropanoyl chloride has a molecular weight of 284.51 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-trichlorogermylpropanoyl chloride is sourced from PubChem (CID 87735387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).