C26H32N2O3 — CID 2051055
2-[4-[(1S)-1-(4-cyclohexylphenyl)ethyl]piperazine-1-carbonyl]benzoic acid (PubChem CID 2051055) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[4-[(1S)-1-(4-cyclohexylphenyl)ethyl]piperazine-1-carbonyl]benzoic acid.
| Compound Name | 2-[4-[(1S)-1-(4-cyclohexylphenyl)ethyl]piperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 2051055 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-[4-[(1S)-1-(4-cyclohexylphenyl)ethyl]piperazine-1-carbonyl]benzoic acid |
| SMILES | C[C@@H](c1ccc(C2CCCCC2)cc1)N1CCN(C(=O)c2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C26H32N2O3/c1-19(20-11-13-22(14-12-20)21-7-3-2-4-8-21)27-15-17-28(18-16-27)25(29)23-9-5-6-10-24(23)26(30)31/h5-6,9-14,19,21H,2-4,7-8,15-18H2,1H3,(H,30,31)/t19-/m0/s1 |
| InChIKey | HUQUIUVTVWCYPX-IBGZPJMESA-N |
| XLogP | 4.95 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |