C17H19N3O2 — CID 20511328
2-[(3-methoxy-4-phenoxyphenyl)methyl]-3,4-dihydropyrazol-5-amine (PubChem CID 20511328) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[(3-methoxy-4-phenoxyphenyl)methyl]-3,4-dihydropyrazol-5-amine.
| Compound Name | 2-[(3-methoxy-4-phenoxyphenyl)methyl]-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 20511328 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(3-methoxy-4-phenoxyphenyl)methyl]-3,4-dihydropyrazol-5-amine |
| SMILES | COc1cc(CN2CCC(N)=N2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-21-16-11-13(12-20-10-9-17(18)19-20)7-8-15(16)22-14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H2,18,19) |
| InChIKey | BVJZFBILDAHCCC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |