C22H26N2O5 — CID 2051210
4-[4-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]piperazine-1-carbonyl]benzoic acid (PubChem CID 2051210) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[4-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]piperazine-1-carbonyl]benzoic acid.
| Compound Name | 4-[4-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]piperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 2051210 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[4-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]piperazine-1-carbonyl]benzoic acid |
| SMILES | COc1ccc([C@@H](C)N2CCN(C(=O)c3ccc(C(=O)O)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-15(19-9-8-18(28-2)14-20(19)29-3)23-10-12-24(13-11-23)21(25)16-4-6-17(7-5-16)22(26)27/h4-9,14-15H,10-13H2,1-3H3,(H,26,27)/t15-/m1/s1 |
| InChIKey | PGTZVFFGJLLMNR-OAHLLOKOSA-N |
| XLogP | 2.92 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |