C23H29BN2O2 — CID 89264833
CID 89264833 (PubChem CID 89264833) has the molecular formula C23H29BN2O2 and a molecular weight of 376.31 g/mol.
| Compound Name | CID 89264833 |
|---|---|
| PubChem CID | 89264833 |
| Molecular Formula | C23H29BN2O2 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)N2CCN(C(C)c3ccc(OC)c(C)c3C)CC2)cc1C |
| InChI | InChI=1S/C23H29BN2O2/c1-15-14-19(6-8-21(15)24)23(27)26-12-10-25(11-13-26)18(4)20-7-9-22(28-5)17(3)16(20)2/h6-9,14,18H,10-13H2,1-5H3 |
| InChIKey | WJQSJTSYYGTSBW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|