C25H33ClN2O4S — CID 11591292
(4-chlorophenyl)-[4-[1-[2,3-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]ethyl]piperazin-1-yl]methanone (PubChem CID 11591292) has the molecular formula C25H33ClN2O4S and a molecular weight of 493.07 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[1-[2,3-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]ethyl]piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[1-[2,3-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11591292 |
| Molecular Formula | C25H33ClN2O4S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (4-chlorophenyl)-[4-[1-[2,3-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1c(OCCCS(C)(=O)=O)ccc(C(C)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c1C |
| InChI | InChI=1S/C25H33ClN2O4S/c1-18-19(2)24(32-16-5-17-33(4,30)31)11-10-23(18)20(3)27-12-14-28(15-13-27)25(29)21-6-8-22(26)9-7-21/h6-11,20H,5,12-17H2,1-4H3 |
| InChIKey | DTNKUDQDQBERPL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|