C29H40F3N3O2 — CID 91207442
[4-[1-[2,3-dimethyl-4-[2-(pentylamino)ethoxy]phenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 91207442) has the molecular formula C29H40F3N3O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is [4-[1-[2,3-dimethyl-4-[2-(pentylamino)ethoxy]phenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[1-[2,3-dimethyl-4-[2-(pentylamino)ethoxy]phenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 91207442 |
| Molecular Formula | C29H40F3N3O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | [4-[1-[2,3-dimethyl-4-[2-(pentylamino)ethoxy]phenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CCCCCNCCOc1ccc(C(C)N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)c(C)c1C |
| InChI | InChI=1S/C29H40F3N3O2/c1-5-6-7-14-33-15-20-37-27-13-12-26(21(2)22(27)3)23(4)34-16-18-35(19-17-34)28(36)24-8-10-25(11-9-24)29(30,31)32/h8-13,23,33H,5-7,14-20H2,1-4H3 |
| InChIKey | LTXNKOVCVKHGNC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|