C30H42F3N3O3 — CID 143169238
2-[4-[2,3-dimethyl-4-[(1S)-1-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethyl]phenoxy]butylamino]ethanol;4-(trifluoromethyl)benzaldehyde (PubChem CID 143169238) has the molecular formula C30H42F3N3O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 2-[4-[2,3-dimethyl-4-[(1S)-1-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethyl]phenoxy]butylamino]ethanol;4-(trifluoromethyl)benzaldehyde.
| Compound Name | 2-[4-[2,3-dimethyl-4-[(1S)-1-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethyl]phenoxy]butylamino]ethanol;4-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 143169238 |
| Molecular Formula | C30H42F3N3O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 2-[4-[2,3-dimethyl-4-[(1S)-1-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethyl]phenoxy]butylamino]ethanol;4-(trifluoromethyl)benzaldehyde |
| SMILES | Cc1c(OCCCCNCCO)ccc([C@H](C)N2CC3CC2CN3C)c1C.O=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H37N3O2.C8H5F3O/c1-16-17(2)22(27-12-6-5-9-23-10-11-26)8-7-21(16)18(3)25-15-19-13-20(25)14-24(19)4;9-8(10,11)7-3-1-6(5-12)2-4-7/h7-8,18-20,23,26H,5-6,9-15H2,1-4H3;1-5H/t18-,19?,20?;/m0./s1 |
| InChIKey | SXEYCLJIEXXRCI-ZBMFEAOPSA-N |
| XLogP | 5.01 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|