C24H30F3N3O2 — CID 11510678
[4-[[4-(3-aminopropoxy)-2,3-dimethylphenyl]methyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 11510678) has the molecular formula C24H30F3N3O2 and a molecular weight of 449.52 g/mol. Its IUPAC name is [4-[[4-(3-aminopropoxy)-2,3-dimethylphenyl]methyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[[4-(3-aminopropoxy)-2,3-dimethylphenyl]methyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 11510678 |
| Molecular Formula | C24H30F3N3O2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | [4-[[4-(3-aminopropoxy)-2,3-dimethylphenyl]methyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(CN2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)ccc(OCCCN)c1C |
| InChI | InChI=1S/C24H30F3N3O2/c1-17-18(2)22(32-15-3-10-28)9-6-20(17)16-29-11-13-30(14-12-29)23(31)19-4-7-21(8-5-19)24(25,26)27/h4-9H,3,10-16,28H2,1-2H3 |
| InChIKey | YDCHUSXFCXFHNF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|