C25H34ClN5O2 — CID 143169382
N-amino-N-[3-[4-[(1R)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-2,3-dimethylphenoxy]propyl]methanimidamide (PubChem CID 143169382) has the molecular formula C25H34ClN5O2 and a molecular weight of 472.03 g/mol. Its IUPAC name is N-amino-N-[3-[4-[(1R)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-2,3-dimethylphenoxy]propyl]methanimidamide.
| Compound Name | N-amino-N-[3-[4-[(1R)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-2,3-dimethylphenoxy]propyl]methanimidamide |
|---|---|
| PubChem CID | 143169382 |
| Molecular Formula | C25H34ClN5O2 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-amino-N-[3-[4-[(1R)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-2,3-dimethylphenoxy]propyl]methanimidamide |
| SMILES | [H]/N=C/N(N)CCCOc1ccc([C@@H](C)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(C)c1C |
| InChI | InChI=1S/C25H34ClN5O2/c1-18-19(2)24(33-16-4-11-31(28)17-27)10-9-23(18)20(3)29-12-14-30(15-13-29)25(32)21-5-7-22(26)8-6-21/h5-10,17,20,27H,4,11-16,28H2,1-3H3/b27-17+/t20-/m1/s1 |
| InChIKey | CHGWNRLBPVDTST-AYQSFACRSA-N |
| XLogP | 4.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|