C27H38ClN3O2 — CID 11540084
(4-chlorophenyl)-[4-[(1R)-1-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]ethyl]piperazin-1-yl]methanone (PubChem CID 11540084) has the molecular formula C27H38ClN3O2 and a molecular weight of 472.07 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[(1R)-1-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]ethyl]piperazin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[(1R)-1-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11540084 |
| Molecular Formula | C27H38ClN3O2 |
| Molecular Weight | 472.07 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | (4-chlorophenyl)-[4-[(1R)-1-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1c(OCCCNC(C)C)ccc([C@@H](C)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c1C |
| InChI | InChI=1S/C27H38ClN3O2/c1-19(2)29-13-6-18-33-26-12-11-25(20(3)21(26)4)22(5)30-14-16-31(17-15-30)27(32)23-7-9-24(28)10-8-23/h7-12,19,22,29H,6,13-18H2,1-5H3/t22-/m1/s1 |
| InChIKey | PALGPXIQXBAXRO-JOCHJYFZSA-N |
| XLogP | 5.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.07 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|