C28H38ClN3O3 — CID 58588692
[(9aS)-6-[4-[3-(2-hydroxyethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chlorophenyl)methanone (PubChem CID 58588692) has the molecular formula C28H38ClN3O3 and a molecular weight of 500.08 g/mol. Its IUPAC name is [(9aS)-6-[4-[3-(2-hydroxyethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chlorophenyl)methanone.
| Compound Name | [(9aS)-6-[4-[3-(2-hydroxyethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 58588692 |
| Molecular Formula | C28H38ClN3O3 |
| Molecular Weight | 500.08 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [(9aS)-6-[4-[3-(2-hydroxyethylamino)propoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(4-chlorophenyl)methanone |
| SMILES | Cc1c(OCCCNCCO)ccc(C2CCC[C@H]3CN(C(=O)c4ccc(Cl)cc4)CCN23)c1C |
| InChI | InChI=1S/C28H38ClN3O3/c1-20-21(2)27(35-18-4-13-30-14-17-33)12-11-25(20)26-6-3-5-24-19-31(15-16-32(24)26)28(34)22-7-9-23(29)10-8-22/h7-12,24,26,30,33H,3-6,13-19H2,1-2H3/t24-,26?/m0/s1 |
| InChIKey | DNJOTXKOOXAXRO-QSAPEBAKSA-N |
| XLogP | 4.36 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.08 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|