C27H36F3N5O2 — CID 58589054
[(6R,9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone (PubChem CID 58589054) has the molecular formula C27H36F3N5O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is [(6R,9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone.
| Compound Name | [(6R,9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 58589054 |
| Molecular Formula | C27H36F3N5O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | [(6R,9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone |
| SMILES | CNCCCCOc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4cnc(C(F)(F)F)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C27H36F3N5O2/c1-18-19(2)24(37-14-5-4-11-31-3)10-9-22(18)23-8-6-7-21-17-34(12-13-35(21)23)25(36)20-15-32-26(33-16-20)27(28,29)30/h9-10,15-16,21,23,31H,4-8,11-14,17H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | RERVDLKFJXPFRC-JTHBVZDNSA-N |
| XLogP | 4.54 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|