C25H31N3O3 — CID 58928398
1-[5-[(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-pyridinyl]ethanone (PubChem CID 58928398) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[5-[(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-pyridinyl]ethanone.
| Compound Name | 1-[5-[(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58928398 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[5-[(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-2-pyridinyl]ethanone |
| SMILES | COc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(C)=O)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C25H31N3O3/c1-16-17(2)24(31-4)11-9-21(16)23-7-5-6-20-15-27(12-13-28(20)23)25(30)19-8-10-22(18(3)29)26-14-19/h8-11,14,20,23H,5-7,12-13,15H2,1-4H3/t20-,23+/m0/s1 |
| InChIKey | OSYREVOBVJRJRO-NZQKXSOJSA-N |
| XLogP | 3.96 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |