C29H40F3N5O3 — CID 143169518
[(6R)-6-[4-[4-[2-hydroxyethyl(methyl)amino]butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone (PubChem CID 143169518) has the molecular formula C29H40F3N5O3 and a molecular weight of 563.67 g/mol. Its IUPAC name is [(6R)-6-[4-[4-[2-hydroxyethyl(methyl)amino]butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone.
| Compound Name | [(6R)-6-[4-[4-[2-hydroxyethyl(methyl)amino]butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 143169518 |
| Molecular Formula | C29H40F3N5O3 |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | [(6R)-6-[4-[4-[2-hydroxyethyl(methyl)amino]butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone |
| SMILES | Cc1c(OCCCCN(C)CCO)ccc([C@H]2CCCC3CN(C(=O)c4cnc(C(F)(F)F)nc4)CCN32)c1C |
| InChI | InChI=1S/C29H40F3N5O3/c1-20-21(2)26(40-16-5-4-11-35(3)14-15-38)10-9-24(20)25-8-6-7-23-19-36(12-13-37(23)25)27(39)22-17-33-28(34-18-22)29(30,31)32/h9-10,17-18,23,25,38H,4-8,11-16,19H2,1-3H3/t23?,25-/m1/s1 |
| InChIKey | KYBZEVMNITYQEJ-XSWBTSGESA-N |
| XLogP | 4.25 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|