C27H33BrF3N3O2 — CID 90694032
[(6R)-6-[4-(4-bromobutoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 90694032) has the molecular formula C27H33BrF3N3O2 and a molecular weight of 568.48 g/mol. Its IUPAC name is [(6R)-6-[4-(4-bromobutoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R)-6-[4-(4-bromobutoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 90694032 |
| Molecular Formula | C27H33BrF3N3O2 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | [(6R)-6-[4-(4-bromobutoxy)-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1c(OCCCCBr)ccc([C@H]2CCCC3CN(C(=O)c4cnccc4C(F)(F)F)CCN32)c1C |
| InChI | InChI=1S/C27H33BrF3N3O2/c1-18-19(2)25(36-15-4-3-11-28)9-8-21(18)24-7-5-6-20-17-33(13-14-34(20)24)26(35)22-16-32-12-10-23(22)27(29,30)31/h8-10,12,16,20,24H,3-7,11,13-15,17H2,1-2H3/t20?,24-/m1/s1 |
| InChIKey | NIXFTKJPTSMMCW-PIFIWZBESA-N |
| XLogP | 6.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|