C29H38F3N3O2 — CID 58588971
[(9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 58588971) has the molecular formula C29H38F3N3O2 and a molecular weight of 517.64 g/mol. Its IUPAC name is [(9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 58588971 |
| Molecular Formula | C29H38F3N3O2 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | [(9aS)-6-[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CNCCCCOc1ccc(C2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)cc4)CCN23)c(C)c1C |
| InChI | InChI=1S/C29H38F3N3O2/c1-20-21(2)27(37-18-5-4-15-33-3)14-13-25(20)26-8-6-7-24-19-34(16-17-35(24)26)28(36)22-9-11-23(12-10-22)29(30,31)32/h9-14,24,26,33H,4-8,15-19H2,1-3H3/t24-,26?/m0/s1 |
| InChIKey | JCODEZCIFXBEMW-QSAPEBAKSA-N |
| XLogP | 5.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|