C28H32F3N3O3 — CID 58589014
[(6R,9aS)-6-[4-[(2R)-2-hydroxy-3-isocyanopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 58589014) has the molecular formula C28H32F3N3O3 and a molecular weight of 515.58 g/mol. Its IUPAC name is [(6R,9aS)-6-[4-[(2R)-2-hydroxy-3-isocyanopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(6R,9aS)-6-[4-[(2R)-2-hydroxy-3-isocyanopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 58589014 |
| Molecular Formula | C28H32F3N3O3 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | [(6R,9aS)-6-[4-[(2R)-2-hydroxy-3-isocyanopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | [C-]#[N+]C[C@@H](O)COc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)cc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C28H32F3N3O3/c1-18-19(2)26(37-17-23(35)15-32-3)12-11-24(18)25-6-4-5-22-16-33(13-14-34(22)25)27(36)20-7-9-21(10-8-20)28(29,30)31/h7-12,22-23,25,35H,4-6,13-17H2,1-2H3/t22-,23+,25+/m0/s1 |
| InChIKey | MJOBSVMPIDKGKE-JBRSBNLGSA-N |
| XLogP | 5.03 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|