C24H28F3N3O2 — CID 69448807
[(6R)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 69448807) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is [(6R)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 69448807 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [(6R)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | COc1ccc([C@H]2CCCC3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C24H28F3N3O2/c1-15-16(2)21(32-3)9-8-19(15)20-6-4-5-18-14-29(11-12-30(18)20)23(31)17-7-10-22(28-13-17)24(25,26)27/h7-10,13,18,20H,4-6,11-12,14H2,1-3H3/t18?,20-/m1/s1 |
| InChIKey | CHTHIURALGJWIC-ROPPNANJSA-N |
| XLogP | 4.78 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |