C24H31N3O3 — CID 58928385
[(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(6-methoxy-3-pyridinyl)methanone (PubChem CID 58928385) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is [(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(6-methoxy-3-pyridinyl)methanone.
| Compound Name | [(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(6-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 58928385 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | [(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(6-methoxy-3-pyridinyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN3[C@@H](CCC[C@@H]3c3ccc(OC)c(C)c3C)C2)cn1 |
| InChI | InChI=1S/C24H31N3O3/c1-16-17(2)22(29-3)10-9-20(16)21-7-5-6-19-15-26(12-13-27(19)21)24(28)18-8-11-23(30-4)25-14-18/h8-11,14,19,21H,5-7,12-13,15H2,1-4H3/t19-,21+/m0/s1 |
| InChIKey | OJKAXOAKPBGBDM-PZJWPPBQSA-N |
| XLogP | 3.77 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |